C20H20Cl2N2O2 — CID 109139494
1-N-(2,3-dichlorophenyl)-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109139494) has the molecular formula C20H20Cl2N2O2 and a molecular weight of 391.30 g/mol. Its IUPAC name is 1-N-(2,3-dichlorophenyl)-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(2,3-dichlorophenyl)-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109139494 |
| Molecular Formula | C20H20Cl2N2O2 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-N-(2,3-dichlorophenyl)-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1CC1C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H20Cl2N2O2/c21-16-9-4-10-17(18(16)22)24-20(26)15-12-14(15)19(25)23-11-5-8-13-6-2-1-3-7-13/h1-4,6-7,9-10,14-15H,5,8,11-12H2,(H,23,25)(H,24,26) |
| InChIKey | PGYOFNZXNNFOPZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|