C16H21ClN2O2 — CID 109131326
2-N-butyl-1-N-(3-chloro-2-methylphenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109131326) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 2-N-butyl-1-N-(3-chloro-2-methylphenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-butyl-1-N-(3-chloro-2-methylphenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109131326 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-N-butyl-1-N-(3-chloro-2-methylphenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | CCCCNC(=O)C1CC1C(=O)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C16H21ClN2O2/c1-3-4-8-18-15(20)11-9-12(11)16(21)19-14-7-5-6-13(17)10(14)2/h5-7,11-12H,3-4,8-9H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | IAHWGTDWBRYIQZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|