C17H24N2O3 — CID 109140052
1-N-(2-methoxyphenyl)-2-N-pentylcyclopropane-1,2-dicarboxamide (PubChem CID 109140052) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-N-(2-methoxyphenyl)-2-N-pentylcyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(2-methoxyphenyl)-2-N-pentylcyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109140052 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-N-(2-methoxyphenyl)-2-N-pentylcyclopropane-1,2-dicarboxamide |
| SMILES | CCCCCNC(=O)C1CC1C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C17H24N2O3/c1-3-4-7-10-18-16(20)12-11-13(12)17(21)19-14-8-5-6-9-15(14)22-2/h5-6,8-9,12-13H,3-4,7,10-11H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | RHQHHLKHAZFEDA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|