C17H24N2O2 — CID 109131309
2-N-butyl-1-N-(2,3-dimethylphenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109131309) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-N-butyl-1-N-(2,3-dimethylphenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-butyl-1-N-(2,3-dimethylphenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109131309 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-N-butyl-1-N-(2,3-dimethylphenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | CCCCNC(=O)C1CC1C(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C17H24N2O2/c1-4-5-9-18-16(20)13-10-14(13)17(21)19-15-8-6-7-11(2)12(15)3/h6-8,13-14H,4-5,9-10H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | MBAXQJBUKFRULS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|