C15H19FN2O2 — CID 109131322
2-N-butyl-1-N-(4-fluorophenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109131322) has the molecular formula C15H19FN2O2 and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-N-butyl-1-N-(4-fluorophenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-butyl-1-N-(4-fluorophenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109131322 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-N-butyl-1-N-(4-fluorophenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | CCCCNC(=O)C1CC1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FN2O2/c1-2-3-8-17-14(19)12-9-13(12)15(20)18-11-6-4-10(16)5-7-11/h4-7,12-13H,2-3,8-9H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | HXBVXBYWPILZLO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|