C26H26N2O2 — CID 109137430
1-N-benzyl-1-N-phenyl-2-N-(2-phenylethyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109137430) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 1-N-benzyl-1-N-phenyl-2-N-(2-phenylethyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-benzyl-1-N-phenyl-2-N-(2-phenylethyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109137430 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-N-benzyl-1-N-phenyl-2-N-(2-phenylethyl)cyclopropane-1,2-dicarboxamide |
| SMILES | O=C(NCCc1ccccc1)C1CC1C(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O2/c29-25(27-17-16-20-10-4-1-5-11-20)23-18-24(23)26(30)28(22-14-8-3-9-15-22)19-21-12-6-2-7-13-21/h1-15,23-24H,16-19H2,(H,27,29) |
| InChIKey | XTNBCVJRNZEJAY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |