C24H21FN2O2 — CID 109143982
1-N-benzyl-2-N-(3-fluorophenyl)-1-N-phenylcyclopropane-1,2-dicarboxamide (PubChem CID 109143982) has the molecular formula C24H21FN2O2 and a molecular weight of 388.44 g/mol. Its IUPAC name is 1-N-benzyl-2-N-(3-fluorophenyl)-1-N-phenylcyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-benzyl-2-N-(3-fluorophenyl)-1-N-phenylcyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109143982 |
| Molecular Formula | C24H21FN2O2 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 1-N-benzyl-2-N-(3-fluorophenyl)-1-N-phenylcyclopropane-1,2-dicarboxamide |
| SMILES | O=C(Nc1cccc(F)c1)C1CC1C(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21FN2O2/c25-18-10-7-11-19(14-18)26-23(28)21-15-22(21)24(29)27(20-12-5-2-6-13-20)16-17-8-3-1-4-9-17/h1-14,21-22H,15-16H2,(H,26,28) |
| InChIKey | TXXCUFMFMWEMAB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |