C19H19BrN2O2 — CID 109135850
1-N-benzyl-2-N-(3-bromophenyl)-1-N-methylcyclopropane-1,2-dicarboxamide (PubChem CID 109135850) has the molecular formula C19H19BrN2O2 and a molecular weight of 387.28 g/mol. Its IUPAC name is 1-N-benzyl-2-N-(3-bromophenyl)-1-N-methylcyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-benzyl-2-N-(3-bromophenyl)-1-N-methylcyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109135850 |
| Molecular Formula | C19H19BrN2O2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 1-N-benzyl-2-N-(3-bromophenyl)-1-N-methylcyclopropane-1,2-dicarboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)C1CC1C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C19H19BrN2O2/c1-22(12-13-6-3-2-4-7-13)19(24)17-11-16(17)18(23)21-15-9-5-8-14(20)10-15/h2-10,16-17H,11-12H2,1H3,(H,21,23) |
| InChIKey | LPFUAOVBRGDKKC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |