C16H22BrN3O2 — CID 109134103
1-N-(3-bromophenyl)-2-N-[3-(dimethylamino)propyl]cyclopropane-1,2-dicarboxamide (PubChem CID 109134103) has the molecular formula C16H22BrN3O2 and a molecular weight of 368.28 g/mol. Its IUPAC name is 1-N-(3-bromophenyl)-2-N-[3-(dimethylamino)propyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(3-bromophenyl)-2-N-[3-(dimethylamino)propyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109134103 |
| Molecular Formula | C16H22BrN3O2 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 1-N-(3-bromophenyl)-2-N-[3-(dimethylamino)propyl]cyclopropane-1,2-dicarboxamide |
| SMILES | CN(C)CCCNC(=O)C1CC1C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C16H22BrN3O2/c1-20(2)8-4-7-18-15(21)13-10-14(13)16(22)19-12-6-3-5-11(17)9-12/h3,5-6,9,13-14H,4,7-8,10H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | QOWHWZAJCGEYCA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|