C15H19BrN2O3 — CID 109133234
1-N-(3-bromophenyl)-2-N-(3-methoxypropyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109133234) has the molecular formula C15H19BrN2O3 and a molecular weight of 355.23 g/mol. Its IUPAC name is 1-N-(3-bromophenyl)-2-N-(3-methoxypropyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(3-bromophenyl)-2-N-(3-methoxypropyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109133234 |
| Molecular Formula | C15H19BrN2O3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 1-N-(3-bromophenyl)-2-N-(3-methoxypropyl)cyclopropane-1,2-dicarboxamide |
| SMILES | COCCCNC(=O)C1CC1C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C15H19BrN2O3/c1-21-7-3-6-17-14(19)12-9-13(12)15(20)18-11-5-2-4-10(16)8-11/h2,4-5,8,12-13H,3,6-7,9H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | SRCXQGBKVATSAZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|