C22H24N2O5 — CID 109139542
1-N-(3-acetylphenyl)-2-N-[2-(4-methoxyphenoxy)ethyl]cyclopropane-1,2-dicarboxamide (PubChem CID 109139542) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 1-N-(3-acetylphenyl)-2-N-[2-(4-methoxyphenoxy)ethyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(3-acetylphenyl)-2-N-[2-(4-methoxyphenoxy)ethyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109139542 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-N-(3-acetylphenyl)-2-N-[2-(4-methoxyphenoxy)ethyl]cyclopropane-1,2-dicarboxamide |
| SMILES | COc1ccc(OCCNC(=O)C2CC2C(=O)Nc2cccc(C(C)=O)c2)cc1 |
| InChI | InChI=1S/C22H24N2O5/c1-14(25)15-4-3-5-16(12-15)24-22(27)20-13-19(20)21(26)23-10-11-29-18-8-6-17(28-2)7-9-18/h3-9,12,19-20H,10-11,13H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | WQCUNELIHBWKFS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|