C22H26N2O4 — CID 109139522
1-N-(2,6-dimethylphenyl)-2-N-[2-(4-methoxyphenoxy)ethyl]cyclopropane-1,2-dicarboxamide (PubChem CID 109139522) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-N-(2,6-dimethylphenyl)-2-N-[2-(4-methoxyphenoxy)ethyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(2,6-dimethylphenyl)-2-N-[2-(4-methoxyphenoxy)ethyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109139522 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-N-(2,6-dimethylphenyl)-2-N-[2-(4-methoxyphenoxy)ethyl]cyclopropane-1,2-dicarboxamide |
| SMILES | COc1ccc(OCCNC(=O)C2CC2C(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-14-5-4-6-15(2)20(14)24-22(26)19-13-18(19)21(25)23-11-12-28-17-9-7-16(27-3)8-10-17/h4-10,18-19H,11-13H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | RJFGZESGVMESFP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|