C15H18Cl2N2O3 — CID 109133253
1-N-(2,6-dichlorophenyl)-2-N-(3-methoxypropyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109133253) has the molecular formula C15H18Cl2N2O3 and a molecular weight of 345.23 g/mol. Its IUPAC name is 1-N-(2,6-dichlorophenyl)-2-N-(3-methoxypropyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(2,6-dichlorophenyl)-2-N-(3-methoxypropyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109133253 |
| Molecular Formula | C15H18Cl2N2O3 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-N-(2,6-dichlorophenyl)-2-N-(3-methoxypropyl)cyclopropane-1,2-dicarboxamide |
| SMILES | COCCCNC(=O)C1CC1C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H18Cl2N2O3/c1-22-7-3-6-18-14(20)9-8-10(9)15(21)19-13-11(16)4-2-5-12(13)17/h2,4-5,9-10H,3,6-8H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | VEZQXIMJKCTUML-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|