C19H28FN3O2 — CID 109147342
1-N-[3-(dimethylamino)propyl]-4-N-(3-fluorophenyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109147342) has the molecular formula C19H28FN3O2 and a molecular weight of 349.45 g/mol. Its IUPAC name is 1-N-[3-(dimethylamino)propyl]-4-N-(3-fluorophenyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N-[3-(dimethylamino)propyl]-4-N-(3-fluorophenyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109147342 |
| Molecular Formula | C19H28FN3O2 |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 1-N-[3-(dimethylamino)propyl]-4-N-(3-fluorophenyl)cyclohexane-1,4-dicarboxamide |
| SMILES | CN(C)CCCNC(=O)C1CCC(C(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C19H28FN3O2/c1-23(2)12-4-11-21-18(24)14-7-9-15(10-8-14)19(25)22-17-6-3-5-16(20)13-17/h3,5-6,13-15H,4,7-12H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | BRVFWVKCEROJNG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|