C20H28N4O2 — CID 109147349
4-N-(3-cyanophenyl)-1-N-[3-(dimethylamino)propyl]cyclohexane-1,4-dicarboxamide (PubChem CID 109147349) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 4-N-(3-cyanophenyl)-1-N-[3-(dimethylamino)propyl]cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(3-cyanophenyl)-1-N-[3-(dimethylamino)propyl]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109147349 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 4-N-(3-cyanophenyl)-1-N-[3-(dimethylamino)propyl]cyclohexane-1,4-dicarboxamide |
| SMILES | CN(C)CCCNC(=O)C1CCC(C(=O)Nc2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C20H28N4O2/c1-24(2)12-4-11-22-19(25)16-7-9-17(10-8-16)20(26)23-18-6-3-5-15(13-18)14-21/h3,5-6,13,16-17H,4,7-12H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | KJBFRFMWOSQBBR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|