C21H20NO3- — CID 6969329
(1R,6S)-6-[benzyl(phenyl)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 6969329) has the molecular formula C21H20NO3- and a molecular weight of 334.40 g/mol. Its IUPAC name is (1R,6S)-6-[benzyl(phenyl)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1R,6S)-6-[benzyl(phenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 6969329 |
| Molecular Formula | C21H20NO3- |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (1R,6S)-6-[benzyl(phenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | O=C([O-])[C@@H]1CC=CC[C@@H]1C(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21NO3/c23-20(18-13-7-8-14-19(18)21(24)25)22(17-11-5-2-6-12-17)15-16-9-3-1-4-10-16/h1-12,18-19H,13-15H2,(H,24,25)/p-1/t18-,19+/m0/s1 |
| InChIKey | GYJWLSOZBMNVGB-RBUKOAKNSA-M |
| XLogP | 2.55 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|