C20H28N2O2 — CID 109137355
1-N-cycloheptyl-2-N-(2-phenylethyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109137355) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-N-cycloheptyl-2-N-(2-phenylethyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-cycloheptyl-2-N-(2-phenylethyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109137355 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1-N-cycloheptyl-2-N-(2-phenylethyl)cyclopropane-1,2-dicarboxamide |
| SMILES | O=C(NCCc1ccccc1)C1CC1C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C20H28N2O2/c23-19(21-13-12-15-8-4-3-5-9-15)17-14-18(17)20(24)22-16-10-6-1-2-7-11-16/h3-5,8-9,16-18H,1-2,6-7,10-14H2,(H,21,23)(H,22,24) |
| InChIKey | QHTZTUKADSINBZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |