C18H24N2O4S — CID 109138178
1-N-(1,1-dioxothiolan-3-yl)-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109138178) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-N-(1,1-dioxothiolan-3-yl)-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(1,1-dioxothiolan-3-yl)-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109138178 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-N-(1,1-dioxothiolan-3-yl)-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1CC1C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H24N2O4S/c21-17(19-9-4-7-13-5-2-1-3-6-13)15-11-16(15)18(22)20-14-8-10-25(23,24)12-14/h1-3,5-6,14-16H,4,7-12H2,(H,19,21)(H,20,22) |
| InChIKey | LYEDZDSJMFTABU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|