C18H27N3O3S — CID 113109683
N-(1,1-dioxothiolan-3-yl)-4-(3-phenylpropyl)piperazine-1-carboxamide (PubChem CID 113109683) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-(3-phenylpropyl)piperazine-1-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-(3-phenylpropyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113109683 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-(3-phenylpropyl)piperazine-1-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)N1CCN(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H27N3O3S/c22-18(19-17-8-14-25(23,24)15-17)21-12-10-20(11-13-21)9-4-7-16-5-2-1-3-6-16/h1-3,5-6,17H,4,7-15H2,(H,19,22) |
| InChIKey | NJDVUGMADLUPES-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |