C24H30N2O4S — CID 45207748
N-(1,1-dioxothiolan-3-yl)-4-[1-(2-phenylethyl)piperidin-4-yl]oxybenzamide (PubChem CID 45207748) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-[1-(2-phenylethyl)piperidin-4-yl]oxybenzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-[1-(2-phenylethyl)piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 45207748 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-[1-(2-phenylethyl)piperidin-4-yl]oxybenzamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1ccc(OC2CCN(CCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H30N2O4S/c27-24(25-21-13-17-31(28,29)18-21)20-6-8-22(9-7-20)30-23-11-15-26(16-12-23)14-10-19-4-2-1-3-5-19/h1-9,21,23H,10-18H2,(H,25,27) |
| InChIKey | RQXOKBKZZRFBOP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |