C27H34N2O4 — CID 25385977
methyl 1-[4-[1-(2-phenylethyl)piperidin-4-yl]oxybenzoyl]piperidine-4-carboxylate (PubChem CID 25385977) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is methyl 1-[4-[1-(2-phenylethyl)piperidin-4-yl]oxybenzoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[4-[1-(2-phenylethyl)piperidin-4-yl]oxybenzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 25385977 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | methyl 1-[4-[1-(2-phenylethyl)piperidin-4-yl]oxybenzoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2ccc(OC3CCN(CCc4ccccc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C27H34N2O4/c1-32-27(31)23-12-19-29(20-13-23)26(30)22-7-9-24(10-8-22)33-25-14-17-28(18-15-25)16-11-21-5-3-2-4-6-21/h2-10,23,25H,11-20H2,1H3 |
| InChIKey | IJPCNCVPDQOCSX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |