C28H39N3O2 — CID 42527447
N-methyl-4-[1-(2-phenylethyl)piperidin-4-yl]oxy-N-(2-piperidin-1-ylethyl)benzamide (PubChem CID 42527447) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is N-methyl-4-[1-(2-phenylethyl)piperidin-4-yl]oxy-N-(2-piperidin-1-ylethyl)benzamide.
| Compound Name | N-methyl-4-[1-(2-phenylethyl)piperidin-4-yl]oxy-N-(2-piperidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 42527447 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | N-methyl-4-[1-(2-phenylethyl)piperidin-4-yl]oxy-N-(2-piperidin-1-ylethyl)benzamide |
| SMILES | CN(CCN1CCCCC1)C(=O)c1ccc(OC2CCN(CCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H39N3O2/c1-29(22-23-30-17-6-3-7-18-30)28(32)25-10-12-26(13-11-25)33-27-15-20-31(21-16-27)19-14-24-8-4-2-5-9-24/h2,4-5,8-13,27H,3,6-7,14-23H2,1H3 |
| InChIKey | MUDVTSMTBBREJZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |