C28H38N2O3 — CID 25281267
N-[[(2R)-oxolan-2-yl]methyl]-4-[1-(2-phenylethyl)piperidin-4-yl]oxy-N-propylbenzamide (PubChem CID 25281267) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-4-[1-(2-phenylethyl)piperidin-4-yl]oxy-N-propylbenzamide.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-4-[1-(2-phenylethyl)piperidin-4-yl]oxy-N-propylbenzamide |
|---|---|
| PubChem CID | 25281267 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-4-[1-(2-phenylethyl)piperidin-4-yl]oxy-N-propylbenzamide |
| SMILES | CCCN(C[C@H]1CCCO1)C(=O)c1ccc(OC2CCN(CCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H38N2O3/c1-2-17-30(22-27-9-6-21-32-27)28(31)24-10-12-25(13-11-24)33-26-15-19-29(20-16-26)18-14-23-7-4-3-5-8-23/h3-5,7-8,10-13,26-27H,2,6,9,14-22H2,1H3/t27-/m1/s1 |
| InChIKey | FDCGDZDAGRZLNS-HHHXNRCGSA-N |
| XLogP | 4.80 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |