C26H30N2O2 — CID 28739164
4-[1-(2-phenylethyl)piperidin-4-yl]oxy-N-prop-2-enyl-N-prop-2-ynylbenzamide (PubChem CID 28739164) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 4-[1-(2-phenylethyl)piperidin-4-yl]oxy-N-prop-2-enyl-N-prop-2-ynylbenzamide.
| Compound Name | 4-[1-(2-phenylethyl)piperidin-4-yl]oxy-N-prop-2-enyl-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 28739164 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 4-[1-(2-phenylethyl)piperidin-4-yl]oxy-N-prop-2-enyl-N-prop-2-ynylbenzamide |
| SMILES | C#CCN(CC=C)C(=O)c1ccc(OC2CCN(CCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H30N2O2/c1-3-17-28(18-4-2)26(29)23-10-12-24(13-11-23)30-25-15-20-27(21-16-25)19-14-22-8-6-5-7-9-22/h1,4-13,25H,2,14-21H2 |
| InChIKey | AXISVDYPLSTABQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|