C27H36N2O2 — CID 25372785
[4-[1-[(3R)-3-phenylbutyl]piperidin-4-yl]oxyphenyl]-piperidin-1-ylmethanone (PubChem CID 25372785) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is [4-[1-[(3R)-3-phenylbutyl]piperidin-4-yl]oxyphenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-[1-[(3R)-3-phenylbutyl]piperidin-4-yl]oxyphenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 25372785 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | [4-[1-[(3R)-3-phenylbutyl]piperidin-4-yl]oxyphenyl]-piperidin-1-ylmethanone |
| SMILES | C[C@H](CCN1CCC(Oc2ccc(C(=O)N3CCCCC3)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C27H36N2O2/c1-22(23-8-4-2-5-9-23)14-19-28-20-15-26(16-21-28)31-25-12-10-24(11-13-25)27(30)29-17-6-3-7-18-29/h2,4-5,8-13,22,26H,3,6-7,14-21H2,1H3/t22-/m1/s1 |
| InChIKey | XXAFNNROTBTCNL-JOCHJYFZSA-N |
| XLogP | 5.35 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |