C24H29FN2O2 — CID 24790458
[4-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]oxyphenyl]-piperidin-1-ylmethanone (PubChem CID 24790458) has the molecular formula C24H29FN2O2 and a molecular weight of 396.51 g/mol. Its IUPAC name is [4-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]oxyphenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]oxyphenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 24790458 |
| Molecular Formula | C24H29FN2O2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | [4-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]oxyphenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(OC2CCN(Cc3cccc(F)c3)CC2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C24H29FN2O2/c25-21-6-4-5-19(17-21)18-26-15-11-23(12-16-26)29-22-9-7-20(8-10-22)24(28)27-13-2-1-3-14-27/h4-10,17,23H,1-3,11-16,18H2 |
| InChIKey | XLZSAMZGZZPSBM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |