C21H26N2O3 — CID 42382175
[4-[1-(furan-3-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone (PubChem CID 42382175) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is [4-[1-(furan-3-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[1-(furan-3-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 42382175 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | [4-[1-(furan-3-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccc(OC2CCN(Cc3ccoc3)CC2)cc1)N1CCCC1 |
| InChI | InChI=1S/C21H26N2O3/c24-21(23-10-1-2-11-23)18-3-5-19(6-4-18)26-20-7-12-22(13-8-20)15-17-9-14-25-16-17/h3-6,9,14,16,20H,1-2,7-8,10-13,15H2 |
| InChIKey | NHMVKNMSNIWZRL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |