C18H25FN2O — CID 171335916
N-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]-N-methylcyclobutanecarboxamide (PubChem CID 171335916) has the molecular formula C18H25FN2O and a molecular weight of 304.41 g/mol. Its IUPAC name is N-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]-N-methylcyclobutanecarboxamide.
| Compound Name | N-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]-N-methylcyclobutanecarboxamide |
|---|---|
| PubChem CID | 171335916 |
| Molecular Formula | C18H25FN2O |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | N-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]-N-methylcyclobutanecarboxamide |
| SMILES | CN(C(=O)C1CCC1)C1CCN(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H25FN2O/c1-20(18(22)15-5-3-6-15)17-8-10-21(11-9-17)13-14-4-2-7-16(19)12-14/h2,4,7,12,15,17H,3,5-6,8-11,13H2,1H3 |
| InChIKey | UGJGKFCRKYPBFU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |