C13H18FNO — CID 129393398
(3S,4S)-1-[(3-fluorophenyl)methyl]-3-methylpiperidin-4-ol (PubChem CID 129393398) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is (3S,4S)-1-[(3-fluorophenyl)methyl]-3-methylpiperidin-4-ol.
| Compound Name | (3S,4S)-1-[(3-fluorophenyl)methyl]-3-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 129393398 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (3S,4S)-1-[(3-fluorophenyl)methyl]-3-methylpiperidin-4-ol |
| SMILES | C[C@H]1CN(Cc2cccc(F)c2)CC[C@@H]1O |
| InChI | InChI=1S/C13H18FNO/c1-10-8-15(6-5-13(10)16)9-11-3-2-4-12(14)7-11/h2-4,7,10,13,16H,5-6,8-9H2,1H3/t10-,13-/m0/s1 |
| InChIKey | HEUWBLRZNMXLRG-GWCFXTLKSA-N |
| XLogP | 2.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |