C16H22N2O — CID 114681109
1-[[3-(3-aminoprop-1-ynyl)phenyl]methyl]-3-methylpiperidin-4-ol (PubChem CID 114681109) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 1-[[3-(3-aminoprop-1-ynyl)phenyl]methyl]-3-methylpiperidin-4-ol.
| Compound Name | 1-[[3-(3-aminoprop-1-ynyl)phenyl]methyl]-3-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 114681109 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-[[3-(3-aminoprop-1-ynyl)phenyl]methyl]-3-methylpiperidin-4-ol |
| SMILES | CC1CN(Cc2cccc(C#CCN)c2)CCC1O |
| InChI | InChI=1S/C16H22N2O/c1-13-11-18(9-7-16(13)19)12-15-5-2-4-14(10-15)6-3-8-17/h2,4-5,10,13,16,19H,7-9,11-12,17H2,1H3 |
| InChIKey | MUNKASBWNJEYLV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|