C18H25BrN2O — CID 171336029
N-[1-[(2-bromophenyl)methyl]piperidin-4-yl]-N-methylcyclobutanecarboxamide (PubChem CID 171336029) has the molecular formula C18H25BrN2O and a molecular weight of 365.32 g/mol. Its IUPAC name is N-[1-[(2-bromophenyl)methyl]piperidin-4-yl]-N-methylcyclobutanecarboxamide.
| Compound Name | N-[1-[(2-bromophenyl)methyl]piperidin-4-yl]-N-methylcyclobutanecarboxamide |
|---|---|
| PubChem CID | 171336029 |
| Molecular Formula | C18H25BrN2O |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-[1-[(2-bromophenyl)methyl]piperidin-4-yl]-N-methylcyclobutanecarboxamide |
| SMILES | CN(C(=O)C1CCC1)C1CCN(Cc2ccccc2Br)CC1 |
| InChI | InChI=1S/C18H25BrN2O/c1-20(18(22)14-6-4-7-14)16-9-11-21(12-10-16)13-15-5-2-3-8-17(15)19/h2-3,5,8,14,16H,4,6-7,9-13H2,1H3 |
| InChIKey | XNDNDFMPZKFHEO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |