C20H29BrN2O — CID 95617535
1-[(2R)-2-[1-[(2-bromophenyl)methyl]piperidin-4-yl]azepan-1-yl]ethanone (PubChem CID 95617535) has the molecular formula C20H29BrN2O and a molecular weight of 393.37 g/mol. Its IUPAC name is 1-[(2R)-2-[1-[(2-bromophenyl)methyl]piperidin-4-yl]azepan-1-yl]ethanone.
| Compound Name | 1-[(2R)-2-[1-[(2-bromophenyl)methyl]piperidin-4-yl]azepan-1-yl]ethanone |
|---|---|
| PubChem CID | 95617535 |
| Molecular Formula | C20H29BrN2O |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-[(2R)-2-[1-[(2-bromophenyl)methyl]piperidin-4-yl]azepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCCC[C@@H]1C1CCN(Cc2ccccc2Br)CC1 |
| InChI | InChI=1S/C20H29BrN2O/c1-16(24)23-12-6-2-3-9-20(23)17-10-13-22(14-11-17)15-18-7-4-5-8-19(18)21/h4-5,7-8,17,20H,2-3,6,9-15H2,1H3/t20-/m1/s1 |
| InChIKey | AECDAUPPFXJJKP-HXUWFJFHSA-N |
| XLogP | 4.45 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |