C16H23BrN2O2S — CID 163349605
N-[1-[(2-bromophenyl)methyl]piperidin-4-yl]-N-methylcyclopropanesulfonamide (PubChem CID 163349605) has the molecular formula C16H23BrN2O2S and a molecular weight of 387.34 g/mol. Its IUPAC name is N-[1-[(2-bromophenyl)methyl]piperidin-4-yl]-N-methylcyclopropanesulfonamide.
| Compound Name | N-[1-[(2-bromophenyl)methyl]piperidin-4-yl]-N-methylcyclopropanesulfonamide |
|---|---|
| PubChem CID | 163349605 |
| Molecular Formula | C16H23BrN2O2S |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | N-[1-[(2-bromophenyl)methyl]piperidin-4-yl]-N-methylcyclopropanesulfonamide |
| SMILES | CN(C1CCN(Cc2ccccc2Br)CC1)S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C16H23BrN2O2S/c1-18(22(20,21)15-6-7-15)14-8-10-19(11-9-14)12-13-4-2-3-5-16(13)17/h2-5,14-15H,6-12H2,1H3 |
| InChIKey | OUYILHPOAOFAOI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |