C14H19N3O5S — CID 110706168
N-(1,1-dioxothiolan-3-yl)-4-(furan-2-carbonyl)piperazine-1-carboxamide (PubChem CID 110706168) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-(furan-2-carbonyl)piperazine-1-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-(furan-2-carbonyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110706168 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-(furan-2-carbonyl)piperazine-1-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C14H19N3O5S/c18-13(12-2-1-8-22-12)16-4-6-17(7-5-16)14(19)15-11-3-9-23(20,21)10-11/h1-2,8,11H,3-7,9-10H2,(H,15,19) |
| InChIKey | GHYYMAPOEUSVSP-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |