C15H23BrN3O2S2+ — CID 9237348
2-[(3-bromophenyl)carbamothioyl-[(3R)-1,1-dioxothiolan-3-yl]amino]ethyl-dimethylazanium (PubChem CID 9237348) has the molecular formula C15H23BrN3O2S2+ and a molecular weight of 421.41 g/mol. Its IUPAC name is 2-[(3-bromophenyl)carbamothioyl-[(3R)-1,1-dioxothiolan-3-yl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[(3-bromophenyl)carbamothioyl-[(3R)-1,1-dioxothiolan-3-yl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 9237348 |
| Molecular Formula | C15H23BrN3O2S2+ |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 2-[(3-bromophenyl)carbamothioyl-[(3R)-1,1-dioxothiolan-3-yl]amino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCN(C(=S)Nc1cccc(Br)c1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H22BrN3O2S2/c1-18(2)7-8-19(14-6-9-23(20,21)11-14)15(22)17-13-5-3-4-12(16)10-13/h3-5,10,14H,6-9,11H2,1-2H3,(H,17,22)/p+1/t14-/m1/s1 |
| InChIKey | GKEPANQZTMACBU-CQSZACIVSA-O |
| XLogP | 0.78 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|