C14H19BrN2O2S2 — CID 9235787
3-(3-bromophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-propylthiourea (PubChem CID 9235787) has the molecular formula C14H19BrN2O2S2 and a molecular weight of 391.36 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-propylthiourea.
| Compound Name | 3-(3-bromophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-propylthiourea |
|---|---|
| PubChem CID | 9235787 |
| Molecular Formula | C14H19BrN2O2S2 |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 3-(3-bromophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-propylthiourea |
| SMILES | CCCN(C(=S)Nc1cccc(Br)c1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H19BrN2O2S2/c1-2-7-17(13-6-8-21(18,19)10-13)14(20)16-12-5-3-4-11(15)9-12/h3-5,9,13H,2,6-8,10H2,1H3,(H,16,20)/t13-/m1/s1 |
| InChIKey | UMZVDDURAJKEMQ-CYBMUJFWSA-N |
| XLogP | 3.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|