C7H12KNO3S3 — CID 18876358
potassium N-(1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)carbamodithioate (PubChem CID 18876358) has the molecular formula C7H12KNO3S3 and a molecular weight of 293.48 g/mol. Its IUPAC name is potassium N-(1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)carbamodithioate.
| Compound Name | potassium N-(1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)carbamodithioate |
|---|---|
| PubChem CID | 18876358 |
| Molecular Formula | C7H12KNO3S3 |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 292.96 |
| IUPAC Name | potassium N-(1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)carbamodithioate |
| SMILES | O=S1(=O)CCC(N(CCO)C(=S)[S-])C1.[K+] |
| InChI | InChI=1S/C7H13NO3S3.K/c9-3-2-8(7(12)13)6-1-4-14(10,11)5-6;/h6,9H,1-5H2,(H,12,13);/q;+1/p-1 |
| InChIKey | YURZOSILNWHFNG-UHFFFAOYSA-M |
| XLogP | -3.70 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|