C7H12KNO4S3 — CID 18876359
potassium N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)carbamodithioate (PubChem CID 18876359) has the molecular formula C7H12KNO4S3 and a molecular weight of 309.48 g/mol. Its IUPAC name is potassium N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)carbamodithioate.
| Compound Name | potassium N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)carbamodithioate |
|---|---|
| PubChem CID | 18876359 |
| Molecular Formula | C7H12KNO4S3 |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | potassium N-(4-hydroxy-1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)carbamodithioate |
| SMILES | O=S1(=O)CC(O)C(N(CCO)C(=S)[S-])C1.[K+] |
| InChI | InChI=1S/C7H13NO4S3.K/c9-2-1-8(7(13)14)5-3-15(11,12)4-6(5)10;/h5-6,9-10H,1-4H2,(H,13,14);/q;+1/p-1 |
| InChIKey | MTWOCZNGLBKJPX-UHFFFAOYSA-M |
| XLogP | -4.73 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | -4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|