C13H28N2O3S — CID 102995842
4-[3-(diethylamino)propyl-ethylamino]-1,1-dioxothiolan-3-ol (PubChem CID 102995842) has the molecular formula C13H28N2O3S and a molecular weight of 292.44 g/mol. Its IUPAC name is 4-[3-(diethylamino)propyl-ethylamino]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[3-(diethylamino)propyl-ethylamino]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 102995842 |
| Molecular Formula | C13H28N2O3S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 4-[3-(diethylamino)propyl-ethylamino]-1,1-dioxothiolan-3-ol |
| SMILES | CCN(CC)CCCN(CC)C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C13H28N2O3S/c1-4-14(5-2)8-7-9-15(6-3)12-10-19(17,18)11-13(12)16/h12-13,16H,4-11H2,1-3H3 |
| InChIKey | UIAKBNUHJSHNBC-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |