C11H21NO3S — CID 126846815
(3S,4S)-4-[cyclobutyl(propyl)amino]-1,1-dioxothiolan-3-ol (PubChem CID 126846815) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is (3S,4S)-4-[cyclobutyl(propyl)amino]-1,1-dioxothiolan-3-ol.
| Compound Name | (3S,4S)-4-[cyclobutyl(propyl)amino]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 126846815 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (3S,4S)-4-[cyclobutyl(propyl)amino]-1,1-dioxothiolan-3-ol |
| SMILES | CCCN(C1CCC1)[C@@H]1CS(=O)(=O)C[C@H]1O |
| InChI | InChI=1S/C11H21NO3S/c1-2-6-12(9-4-3-5-9)10-7-16(14,15)8-11(10)13/h9-11,13H,2-8H2,1H3/t10-,11-/m1/s1 |
| InChIKey | RKPUKIFVCCRLLL-GHMZBOCLSA-N |
| XLogP | 0.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |