C7H13NO4S — CID 99977195
N-ethyl-N-[(3S,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]formamide (PubChem CID 99977195) has the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. Its IUPAC name is N-ethyl-N-[(3S,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]formamide.
| Compound Name | N-ethyl-N-[(3S,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]formamide |
|---|---|
| PubChem CID | 99977195 |
| Molecular Formula | C7H13NO4S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | N-ethyl-N-[(3S,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]formamide |
| SMILES | CCN(C=O)[C@@H]1CS(=O)(=O)C[C@@H]1O |
| InChI | InChI=1S/C7H13NO4S/c1-2-8(5-9)6-3-13(11,12)4-7(6)10/h5-7,10H,2-4H2,1H3/t6-,7+/m1/s1 |
| InChIKey | PSORFIIEKIWCTN-RQJHMYQMSA-N |
| XLogP | -1.38 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|