C10H18N2O4S — CID 133275137
N-[(3S,4S)-4-[formyl(methyl)amino]-1,1-dioxothiolan-3-yl]-N-methylpropanamide (PubChem CID 133275137) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is N-[(3S,4S)-4-[formyl(methyl)amino]-1,1-dioxothiolan-3-yl]-N-methylpropanamide.
| Compound Name | N-[(3S,4S)-4-[formyl(methyl)amino]-1,1-dioxothiolan-3-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 133275137 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | N-[(3S,4S)-4-[formyl(methyl)amino]-1,1-dioxothiolan-3-yl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)[C@@H]1CS(=O)(=O)C[C@H]1N(C)C=O |
| InChI | InChI=1S/C10H18N2O4S/c1-4-10(14)12(3)9-6-17(15,16)5-8(9)11(2)7-13/h7-9H,4-6H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | PIYWISBQKCPVDD-RKDXNWHRSA-N |
| XLogP | -0.89 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|