C8H17NO3S — CID 130683656
(3S)-4-(diethylamino)-1,1-dioxothiolan-3-ol (PubChem CID 130683656) has the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. Its IUPAC name is (3S)-4-(diethylamino)-1,1-dioxothiolan-3-ol.
| Compound Name | (3S)-4-(diethylamino)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 130683656 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (3S)-4-(diethylamino)-1,1-dioxothiolan-3-ol |
| SMILES | CCN(CC)C1CS(=O)(=O)C[C@H]1O |
| InChI | InChI=1S/C8H17NO3S/c1-3-9(4-2)7-5-13(11,12)6-8(7)10/h7-8,10H,3-6H2,1-2H3/t7?,8-/m1/s1 |
| InChIKey | QAOGCKMYQLALKG-BRFYHDHCSA-N |
| XLogP | -0.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |