C12H24N2O3S — CID 79717139
4-[ethyl(piperidin-4-ylmethyl)amino]-1,1-dioxothiolan-3-ol (PubChem CID 79717139) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is 4-[ethyl(piperidin-4-ylmethyl)amino]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[ethyl(piperidin-4-ylmethyl)amino]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 79717139 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 4-[ethyl(piperidin-4-ylmethyl)amino]-1,1-dioxothiolan-3-ol |
| SMILES | CCN(CC1CCNCC1)C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C12H24N2O3S/c1-2-14(7-10-3-5-13-6-4-10)11-8-18(16,17)9-12(11)15/h10-13,15H,2-9H2,1H3 |
| InChIKey | KWXLBPLXNHGLLQ-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |