C14H26N2 — CID 114620607
N-ethyl-N-(piperidin-4-ylmethyl)cyclohex-2-en-1-amine (PubChem CID 114620607) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is N-ethyl-N-(piperidin-4-ylmethyl)cyclohex-2-en-1-amine.
| Compound Name | N-ethyl-N-(piperidin-4-ylmethyl)cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 114620607 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | N-ethyl-N-(piperidin-4-ylmethyl)cyclohex-2-en-1-amine |
| SMILES | CCN(CC1CCNCC1)C1C=CCCC1 |
| InChI | InChI=1S/C14H26N2/c1-2-16(14-6-4-3-5-7-14)12-13-8-10-15-11-9-13/h4,6,13-15H,2-3,5,7-12H2,1H3 |
| InChIKey | YTUIOPGAPIBLMV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|