C12H17NO3S — CID 126846713
(3S,4S)-4-(N-ethylanilino)-1,1-dioxothiolan-3-ol (PubChem CID 126846713) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is (3S,4S)-4-(N-ethylanilino)-1,1-dioxothiolan-3-ol.
| Compound Name | (3S,4S)-4-(N-ethylanilino)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 126846713 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (3S,4S)-4-(N-ethylanilino)-1,1-dioxothiolan-3-ol |
| SMILES | CCN(c1ccccc1)[C@@H]1CS(=O)(=O)C[C@H]1O |
| InChI | InChI=1S/C12H17NO3S/c1-2-13(10-6-4-3-5-7-10)11-8-17(15,16)9-12(11)14/h3-7,11-12,14H,2,8-9H2,1H3/t11-,12-/m1/s1 |
| InChIKey | TUNIDWMBLWHLCP-VXGBXAGGSA-N |
| XLogP | 0.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |