C13H19NO4S — CID 129367138
(3R,4S)-4-[benzyl(2-hydroxyethyl)amino]-1,1-dioxothiolan-3-ol (PubChem CID 129367138) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is (3R,4S)-4-[benzyl(2-hydroxyethyl)amino]-1,1-dioxothiolan-3-ol.
| Compound Name | (3R,4S)-4-[benzyl(2-hydroxyethyl)amino]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 129367138 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (3R,4S)-4-[benzyl(2-hydroxyethyl)amino]-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)C[C@@H](N(CCO)Cc2ccccc2)[C@@H](O)C1 |
| InChI | InChI=1S/C13H19NO4S/c15-7-6-14(8-11-4-2-1-3-5-11)12-9-19(17,18)10-13(12)16/h1-5,12-13,15-16H,6-10H2/t12-,13+/m1/s1 |
| InChIKey | HHWSZRHCIALLQU-OLZOCXBDSA-N |
| XLogP | -0.36 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |