C15H24N2O3S — CID 60885293
4-[3-[benzyl(methyl)amino]propylamino]-1,1-dioxothiolan-3-ol (PubChem CID 60885293) has the molecular formula C15H24N2O3S and a molecular weight of 312.43 g/mol. Its IUPAC name is 4-[3-[benzyl(methyl)amino]propylamino]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[3-[benzyl(methyl)amino]propylamino]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60885293 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 4-[3-[benzyl(methyl)amino]propylamino]-1,1-dioxothiolan-3-ol |
| SMILES | CN(CCCNC1CS(=O)(=O)CC1O)Cc1ccccc1 |
| InChI | InChI=1S/C15H24N2O3S/c1-17(10-13-6-3-2-4-7-13)9-5-8-16-14-11-21(19,20)12-15(14)18/h2-4,6-7,14-16,18H,5,8-12H2,1H3 |
| InChIKey | JPWVWWUUDCHDRH-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|