C9H21ClN2O3S — CID 44657176
3-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]propyl-dimethylazanium chloride (PubChem CID 44657176) has the molecular formula C9H21ClN2O3S and a molecular weight of 272.80 g/mol. Its IUPAC name is 3-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]propyl-dimethylazanium chloride.
| Compound Name | 3-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]propyl-dimethylazanium chloride |
|---|---|
| PubChem CID | 44657176 |
| Molecular Formula | C9H21ClN2O3S |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]propyl-dimethylazanium chloride |
| SMILES | C[NH+](C)CCCNC1CS(=O)(=O)CC1O.[Cl-] |
| InChI | InChI=1S/C9H20N2O3S.ClH/c1-11(2)5-3-4-10-8-6-15(13,14)7-9(8)12;/h8-10,12H,3-7H2,1-2H3;1H |
| InChIKey | ZCWNJPKILUGSOR-UHFFFAOYSA-N |
| XLogP | -5.73 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | -5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|