C7H15NO4S — CID 6347765
(3S,4S)-4-(3-hydroxypropylamino)-1,1-dioxothiolan-3-ol (PubChem CID 6347765) has the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. Its IUPAC name is (3S,4S)-4-(3-hydroxypropylamino)-1,1-dioxothiolan-3-ol.
| Compound Name | (3S,4S)-4-(3-hydroxypropylamino)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 6347765 |
| Molecular Formula | C7H15NO4S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (3S,4S)-4-(3-hydroxypropylamino)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)C[C@@H](O)[C@H](NCCCO)C1 |
| InChI | InChI=1S/C7H15NO4S/c9-3-1-2-8-6-4-13(11,12)5-7(6)10/h6-10H,1-5H2/t6-,7-/m1/s1 |
| InChIKey | UVQDNFWQAJOWAG-RNFRBKRXSA-N |
| XLogP | -1.88 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|